C16H22N2O3S — CID 71870635
N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethylamino)-4-oxobutyl]cyclopropanecarboxamide (PubChem CID 71870635) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethylamino)-4-oxobutyl]cyclopropanecarboxamide.
| Compound Name | N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethylamino)-4-oxobutyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 71870635 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-ylmethylamino)-4-oxobutyl]cyclopropanecarboxamide |
| SMILES | O=C(CCCNC(=O)C1CC1)NCC1OCCc2sccc21 |
| InChI | InChI=1S/C16H22N2O3S/c19-15(2-1-7-17-16(20)11-3-4-11)18-10-13-12-6-9-22-14(12)5-8-21-13/h6,9,11,13H,1-5,7-8,10H2,(H,17,20)(H,18,19) |
| InChIKey | GYGYYOOQRVIRIM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|