C9H15N3OS — CID 71870821
N,N-diethyl-2-(1H-imidazol-2-ylsulfanyl)acetamide (PubChem CID 71870821) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is N,N-diethyl-2-(1H-imidazol-2-ylsulfanyl)acetamide.
| Compound Name | N,N-diethyl-2-(1H-imidazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 71870821 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | N,N-diethyl-2-(1H-imidazol-2-ylsulfanyl)acetamide |
| SMILES | CCN(CC)C(=O)CSc1ncc[nH]1 |
| InChI | InChI=1S/C9H15N3OS/c1-3-12(4-2)8(13)7-14-9-10-5-6-11-9/h5-6H,3-4,7H2,1-2H3,(H,10,11) |
| InChIKey | QASOTPKPUHRQOG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |