C17H23N3O2 — CID 71870948
N-[2-[[3-(hydroxymethyl)quinolin-2-yl]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 71870948) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[2-[[3-(hydroxymethyl)quinolin-2-yl]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[3-(hydroxymethyl)quinolin-2-yl]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 71870948 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-[2-[[3-(hydroxymethyl)quinolin-2-yl]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCNc1nc2ccccc2cc1CO |
| InChI | InChI=1S/C17H23N3O2/c1-17(2,3)16(22)19-9-8-18-15-13(11-21)10-12-6-4-5-7-14(12)20-15/h4-7,10,21H,8-9,11H2,1-3H3,(H,18,20)(H,19,22) |
| InChIKey | GFWSJSBBTNDLFQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|