C17H17ClN4O — CID 71871162
2-(2-chloro-6-cyanoanilino)-N-methyl-N-(2-pyridin-2-ylethyl)acetamide (PubChem CID 71871162) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is 2-(2-chloro-6-cyanoanilino)-N-methyl-N-(2-pyridin-2-ylethyl)acetamide.
| Compound Name | 2-(2-chloro-6-cyanoanilino)-N-methyl-N-(2-pyridin-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 71871162 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-(2-chloro-6-cyanoanilino)-N-methyl-N-(2-pyridin-2-ylethyl)acetamide |
| SMILES | CN(CCc1ccccn1)C(=O)CNc1c(Cl)cccc1C#N |
| InChI | InChI=1S/C17H17ClN4O/c1-22(10-8-14-6-2-3-9-20-14)16(23)12-21-17-13(11-19)5-4-7-15(17)18/h2-7,9,21H,8,10,12H2,1H3 |
| InChIKey | UGRVWVQJWAWBDR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |