About 7-(4-methyl-1,4-diazepan-1-yl)thieno[3,2-b]pyridine
7-(4-methyl-1,4-diazepan-1-yl)thieno[3,2-b]pyridine (PubChem CID 71871284) has the molecular formula C13H17N3S
and a molecular weight of 247.37 g/mol. Its IUPAC name is 7-(4-methyl-1,4-diazepan-1-yl)thieno[3,2-b]pyridine.
Molecular Properties
| Compound Name | 7-(4-methyl-1,4-diazepan-1-yl)thieno[3,2-b]pyridine |
| PubChem CID | 71871284 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 7-(4-methyl-1,4-diazepan-1-yl)thieno[3,2-b]pyridine |
| SMILES | CN1CCCN(c2ccnc3ccsc23)CC1 |
| InChI | InChI=1S/C13H17N3S/c1-15-6-2-7-16(9-8-15)12-3-5-14-11-4-10-17-13(11)12/h3-5,10H,2,6-9H2,1H3 |
| InChIKey | KWYDFXJWSPTLKY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(4-methyl-1,4-diazepan-1-yl)thieno[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-methyl-1,4-diazepan-1-yl)thieno[3,2-b]pyridine?
The IUPAC name of 7-(4-methyl-1,4-diazepan-1-yl)thieno[3,2-b]pyridine (CID 71871284) is 7-(4-methyl-1,4-diazepan-1-yl)thieno[3,2-b]pyridine.
What is the SMILES notation for 7-(4-methyl-1,4-diazepan-1-yl)thieno[3,2-b]pyridine?
The canonical SMILES for 7-(4-methyl-1,4-diazepan-1-yl)thieno[3,2-b]pyridine is CN1CCCN(c2ccnc3ccsc23)CC1.
What is the InChIKey of 7-(4-methyl-1,4-diazepan-1-yl)thieno[3,2-b]pyridine?
The InChIKey is KWYDFXJWSPTLKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3S/c1-15-6-2-7-16(9-8-15)12-3-5-14-11-4-10-17-13(11)12/h3-5,10H,2,6-9H2,1H3.
What are the key properties of 7-(4-methyl-1,4-diazepan-1-yl)thieno[3,2-b]pyridine?
7-(4-methyl-1,4-diazepan-1-yl)thieno[3,2-b]pyridine has a molecular weight of 247.37 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-methyl-1,4-diazepan-1-yl)thieno[3,2-b]pyridine is sourced from PubChem (CID 71871284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).