About 4-(2-fluoroethyl)-3-phenyl-1,2,4-oxadiazol-5-one
4-(2-fluoroethyl)-3-phenyl-1,2,4-oxadiazol-5-one (PubChem CID 71871872) has the molecular formula C10H9FN2O2
and a molecular weight of 208.19 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-3-phenyl-1,2,4-oxadiazol-5-one.
Molecular Properties
| Compound Name | 4-(2-fluoroethyl)-3-phenyl-1,2,4-oxadiazol-5-one |
| PubChem CID | 71871872 |
| Molecular Formula | C10H9FN2O2 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 4-(2-fluoroethyl)-3-phenyl-1,2,4-oxadiazol-5-one |
| SMILES | O=c1onc(-c2ccccc2)n1CCF |
| InChI | InChI=1S/C10H9FN2O2/c11-6-7-13-9(12-15-10(13)14)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | LDBPRROOMNYXNF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-fluoroethyl)-3-phenyl-1,2,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluoroethyl)-3-phenyl-1,2,4-oxadiazol-5-one?
The IUPAC name of 4-(2-fluoroethyl)-3-phenyl-1,2,4-oxadiazol-5-one (CID 71871872) is 4-(2-fluoroethyl)-3-phenyl-1,2,4-oxadiazol-5-one.
What is the SMILES notation for 4-(2-fluoroethyl)-3-phenyl-1,2,4-oxadiazol-5-one?
The canonical SMILES for 4-(2-fluoroethyl)-3-phenyl-1,2,4-oxadiazol-5-one is O=c1onc(-c2ccccc2)n1CCF.
What is the InChIKey of 4-(2-fluoroethyl)-3-phenyl-1,2,4-oxadiazol-5-one?
The InChIKey is LDBPRROOMNYXNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2O2/c11-6-7-13-9(12-15-10(13)14)8-4-2-1-3-5-8/h1-5H,6-7H2.
What are the key properties of 4-(2-fluoroethyl)-3-phenyl-1,2,4-oxadiazol-5-one?
4-(2-fluoroethyl)-3-phenyl-1,2,4-oxadiazol-5-one has a molecular weight of 208.19 g/mol, XLogP of 1.47, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluoroethyl)-3-phenyl-1,2,4-oxadiazol-5-one is sourced from PubChem (CID 71871872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).