C14H20N4O4S — CID 71873007
2-(furan-2-yl)-N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]pyrrolidine-1-sulfonamide (PubChem CID 71873007) has the molecular formula C14H20N4O4S and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-(furan-2-yl)-N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]pyrrolidine-1-sulfonamide.
| Compound Name | 2-(furan-2-yl)-N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 71873007 |
| Molecular Formula | C14H20N4O4S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(furan-2-yl)-N-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]pyrrolidine-1-sulfonamide |
| SMILES | Cc1noc(CCCNS(=O)(=O)N2CCCC2c2ccco2)n1 |
| InChI | InChI=1S/C14H20N4O4S/c1-11-16-14(22-17-11)7-2-8-15-23(19,20)18-9-3-5-12(18)13-6-4-10-21-13/h4,6,10,12,15H,2-3,5,7-9H2,1H3 |
| InChIKey | JALUWJATOSRAIB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|