C17H19ClN4O2 — CID 71873173
2-[4-(4-chlorobenzoyl)piperazin-1-yl]-1-(1-methylpyrazol-4-yl)ethanone (PubChem CID 71873173) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is 2-[4-(4-chlorobenzoyl)piperazin-1-yl]-1-(1-methylpyrazol-4-yl)ethanone.
| Compound Name | 2-[4-(4-chlorobenzoyl)piperazin-1-yl]-1-(1-methylpyrazol-4-yl)ethanone |
|---|---|
| PubChem CID | 71873173 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2-[4-(4-chlorobenzoyl)piperazin-1-yl]-1-(1-methylpyrazol-4-yl)ethanone |
| SMILES | Cn1cc(C(=O)CN2CCN(C(=O)c3ccc(Cl)cc3)CC2)cn1 |
| InChI | InChI=1S/C17H19ClN4O2/c1-20-11-14(10-19-20)16(23)12-21-6-8-22(9-7-21)17(24)13-2-4-15(18)5-3-13/h2-5,10-11H,6-9,12H2,1H3 |
| InChIKey | JZIVHLULSCULJS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |