C20H22INO2 — CID 71873235
[4-(2,3-dimethylphenyl)-4-hydroxypiperidin-1-yl]-(3-iodophenyl)methanone (PubChem CID 71873235) has the molecular formula C20H22INO2 and a molecular weight of 435.31 g/mol. Its IUPAC name is [4-(2,3-dimethylphenyl)-4-hydroxypiperidin-1-yl]-(3-iodophenyl)methanone.
| Compound Name | [4-(2,3-dimethylphenyl)-4-hydroxypiperidin-1-yl]-(3-iodophenyl)methanone |
|---|---|
| PubChem CID | 71873235 |
| Molecular Formula | C20H22INO2 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | [4-(2,3-dimethylphenyl)-4-hydroxypiperidin-1-yl]-(3-iodophenyl)methanone |
| SMILES | Cc1cccc(C2(O)CCN(C(=O)c3cccc(I)c3)CC2)c1C |
| InChI | InChI=1S/C20H22INO2/c1-14-5-3-8-18(15(14)2)20(24)9-11-22(12-10-20)19(23)16-6-4-7-17(21)13-16/h3-8,13,24H,9-12H2,1-2H3 |
| InChIKey | TULCBOIYKQEMRX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|