C15H22N2O2 — CID 71873394
2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone (PubChem CID 71873394) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone.
| Compound Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 71873394 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-(5-propan-2-yl-1,3-oxazol-4-yl)methanone |
| SMILES | CC(C)c1ocnc1C(=O)N1CCCC2CCCC21 |
| InChI | InChI=1S/C15H22N2O2/c1-10(2)14-13(16-9-19-14)15(18)17-8-4-6-11-5-3-7-12(11)17/h9-12H,3-8H2,1-2H3 |
| InChIKey | ABFJZEDDPXVHAN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |