C14H21NO — CID 71874006
1,3,3a,4,7,7a-hexahydroisoindol-2-yl(cyclopentyl)methanone (PubChem CID 71874006) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 1,3,3a,4,7,7a-hexahydroisoindol-2-yl(cyclopentyl)methanone.
| Compound Name | 1,3,3a,4,7,7a-hexahydroisoindol-2-yl(cyclopentyl)methanone |
|---|---|
| PubChem CID | 71874006 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 1,3,3a,4,7,7a-hexahydroisoindol-2-yl(cyclopentyl)methanone |
| SMILES | O=C(C1CCCC1)N1CC2CC=CCC2C1 |
| InChI | InChI=1S/C14H21NO/c16-14(11-5-1-2-6-11)15-9-12-7-3-4-8-13(12)10-15/h3-4,11-13H,1-2,5-10H2 |
| InChIKey | QZMUKQBDNHSLRM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|