About 4-[[(5,8-difluoroquinolin-4-yl)amino]methyl]oxan-4-ol
4-[[(5,8-difluoroquinolin-4-yl)amino]methyl]oxan-4-ol (PubChem CID 71874415) has the molecular formula C15H16F2N2O2
and a molecular weight of 294.30 g/mol. Its IUPAC name is 4-[[(5,8-difluoroquinolin-4-yl)amino]methyl]oxan-4-ol.
Molecular Properties
| Compound Name | 4-[[(5,8-difluoroquinolin-4-yl)amino]methyl]oxan-4-ol |
| PubChem CID | 71874415 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-[[(5,8-difluoroquinolin-4-yl)amino]methyl]oxan-4-ol |
| SMILES | OC1(CNc2ccnc3c(F)ccc(F)c23)CCOCC1 |
| InChI | InChI=1S/C15H16F2N2O2/c16-10-1-2-11(17)14-13(10)12(3-6-18-14)19-9-15(20)4-7-21-8-5-15/h1-3,6,20H,4-5,7-9H2,(H,18,19) |
| InChIKey | FHQDUFYUXZZSLM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(5,8-difluoroquinolin-4-yl)amino]methyl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(5,8-difluoroquinolin-4-yl)amino]methyl]oxan-4-ol?
The IUPAC name of 4-[[(5,8-difluoroquinolin-4-yl)amino]methyl]oxan-4-ol (CID 71874415) is 4-[[(5,8-difluoroquinolin-4-yl)amino]methyl]oxan-4-ol.
What is the SMILES notation for 4-[[(5,8-difluoroquinolin-4-yl)amino]methyl]oxan-4-ol?
The canonical SMILES for 4-[[(5,8-difluoroquinolin-4-yl)amino]methyl]oxan-4-ol is OC1(CNc2ccnc3c(F)ccc(F)c23)CCOCC1.
What is the InChIKey of 4-[[(5,8-difluoroquinolin-4-yl)amino]methyl]oxan-4-ol?
The InChIKey is FHQDUFYUXZZSLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F2N2O2/c16-10-1-2-11(17)14-13(10)12(3-6-18-14)19-9-15(20)4-7-21-8-5-15/h1-3,6,20H,4-5,7-9H2,(H,18,19).
What are the key properties of 4-[[(5,8-difluoroquinolin-4-yl)amino]methyl]oxan-4-ol?
4-[[(5,8-difluoroquinolin-4-yl)amino]methyl]oxan-4-ol has a molecular weight of 294.30 g/mol, XLogP of 2.47, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(5,8-difluoroquinolin-4-yl)amino]methyl]oxan-4-ol is sourced from PubChem (CID 71874415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).