C16H22N4O2 — CID 71874830
1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea (PubChem CID 71874830) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea.
| Compound Name | 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 71874830 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-3-(1-methyl-2-oxopyrrolidin-3-yl)urea |
| SMILES | CN1CCC(NC(=O)Nc2ccc3c(c2)CCCN3C)C1=O |
| InChI | InChI=1S/C16H22N4O2/c1-19-8-3-4-11-10-12(5-6-14(11)19)17-16(22)18-13-7-9-20(2)15(13)21/h5-6,10,13H,3-4,7-9H2,1-2H3,(H2,17,18,22) |
| InChIKey | YCYCJMNQNPNVLL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|