About (3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-(5-propan-2-yl-1,3-oxazol-4-yl)methanone
(3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-(5-propan-2-yl-1,3-oxazol-4-yl)methanone (PubChem CID 71874878) has the molecular formula C15H22N2O4
and a molecular weight of 294.35 g/mol. Its IUPAC name is (3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-(5-propan-2-yl-1,3-oxazol-4-yl)methanone.
Molecular Properties
| Compound Name | (3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-(5-propan-2-yl-1,3-oxazol-4-yl)methanone |
| PubChem CID | 71874878 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-(5-propan-2-yl-1,3-oxazol-4-yl)methanone |
| SMILES | CC1COC2(CCN(C(=O)c3ncoc3C(C)C)CC2)O1 |
| InChI | InChI=1S/C15H22N2O4/c1-10(2)13-12(16-9-19-13)14(18)17-6-4-15(5-7-17)20-8-11(3)21-15/h9-11H,4-8H2,1-3H3 |
| InChIKey | XMTRNBCQFBOOMH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-(5-propan-2-yl-1,3-oxazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-(5-propan-2-yl-1,3-oxazol-4-yl)methanone?
The IUPAC name of (3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-(5-propan-2-yl-1,3-oxazol-4-yl)methanone (CID 71874878) is (3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-(5-propan-2-yl-1,3-oxazol-4-yl)methanone.
What is the SMILES notation for (3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-(5-propan-2-yl-1,3-oxazol-4-yl)methanone?
The canonical SMILES for (3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-(5-propan-2-yl-1,3-oxazol-4-yl)methanone is CC1COC2(CCN(C(=O)c3ncoc3C(C)C)CC2)O1.
What is the InChIKey of (3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-(5-propan-2-yl-1,3-oxazol-4-yl)methanone?
The InChIKey is XMTRNBCQFBOOMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O4/c1-10(2)13-12(16-9-19-13)14(18)17-6-4-15(5-7-17)20-8-11(3)21-15/h9-11H,4-8H2,1-3H3.
What are the key properties of (3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-(5-propan-2-yl-1,3-oxazol-4-yl)methanone?
(3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-(5-propan-2-yl-1,3-oxazol-4-yl)methanone has a molecular weight of 294.35 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-(5-propan-2-yl-1,3-oxazol-4-yl)methanone is sourced from PubChem (CID 71874878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).