C18H20N2O3S — CID 71875065
N-(2-ethylphenyl)-7-sulfamoyl-2,3-dihydro-1H-indene-5-carboxamide (PubChem CID 71875065) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-(2-ethylphenyl)-7-sulfamoyl-2,3-dihydro-1H-indene-5-carboxamide.
| Compound Name | N-(2-ethylphenyl)-7-sulfamoyl-2,3-dihydro-1H-indene-5-carboxamide |
|---|---|
| PubChem CID | 71875065 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-(2-ethylphenyl)-7-sulfamoyl-2,3-dihydro-1H-indene-5-carboxamide |
| SMILES | CCc1ccccc1NC(=O)c1cc2c(c(S(N)(=O)=O)c1)CCC2 |
| InChI | InChI=1S/C18H20N2O3S/c1-2-12-6-3-4-9-16(12)20-18(21)14-10-13-7-5-8-15(13)17(11-14)24(19,22)23/h3-4,6,9-11H,2,5,7-8H2,1H3,(H,20,21)(H2,19,22,23) |
| InChIKey | DBMAHVJPOMSKAE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |