C18H28N4O2 — CID 71876136
6-[2-[(2-cyclopentylacetyl)amino]ethylamino]-N-propylpyridine-3-carboxamide (PubChem CID 71876136) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 6-[2-[(2-cyclopentylacetyl)amino]ethylamino]-N-propylpyridine-3-carboxamide.
| Compound Name | 6-[2-[(2-cyclopentylacetyl)amino]ethylamino]-N-propylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 71876136 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 6-[2-[(2-cyclopentylacetyl)amino]ethylamino]-N-propylpyridine-3-carboxamide |
| SMILES | CCCNC(=O)c1ccc(NCCNC(=O)CC2CCCC2)nc1 |
| InChI | InChI=1S/C18H28N4O2/c1-2-9-21-18(24)15-7-8-16(22-13-15)19-10-11-20-17(23)12-14-5-3-4-6-14/h7-8,13-14H,2-6,9-12H2,1H3,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | UHKJODSPSVLSSR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|