C17H23FN2O2 — CID 71876568
N-[2-[cyclopropyl(2-methylpropyl)amino]-2-oxoethyl]-2-(3-fluorophenyl)acetamide (PubChem CID 71876568) has the molecular formula C17H23FN2O2 and a molecular weight of 306.38 g/mol. Its IUPAC name is N-[2-[cyclopropyl(2-methylpropyl)amino]-2-oxoethyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[2-[cyclopropyl(2-methylpropyl)amino]-2-oxoethyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 71876568 |
| Molecular Formula | C17H23FN2O2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N-[2-[cyclopropyl(2-methylpropyl)amino]-2-oxoethyl]-2-(3-fluorophenyl)acetamide |
| SMILES | CC(C)CN(C(=O)CNC(=O)Cc1cccc(F)c1)C1CC1 |
| InChI | InChI=1S/C17H23FN2O2/c1-12(2)11-20(15-6-7-15)17(22)10-19-16(21)9-13-4-3-5-14(18)8-13/h3-5,8,12,15H,6-7,9-11H2,1-2H3,(H,19,21) |
| InChIKey | CJGORZNPIXMUHE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |