About 6-[[2-(2,4-dimethylpiperazin-1-yl)-2-oxoethyl]-methylamino]pyridine-3-carbonitrile
6-[[2-(2,4-dimethylpiperazin-1-yl)-2-oxoethyl]-methylamino]pyridine-3-carbonitrile (PubChem CID 71877355) has the molecular formula C15H21N5O
and a molecular weight of 287.37 g/mol. Its IUPAC name is 6-[[2-(2,4-dimethylpiperazin-1-yl)-2-oxoethyl]-methylamino]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[[2-(2,4-dimethylpiperazin-1-yl)-2-oxoethyl]-methylamino]pyridine-3-carbonitrile |
| PubChem CID | 71877355 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 6-[[2-(2,4-dimethylpiperazin-1-yl)-2-oxoethyl]-methylamino]pyridine-3-carbonitrile |
| SMILES | CC1CN(C)CCN1C(=O)CN(C)c1ccc(C#N)cn1 |
| InChI | InChI=1S/C15H21N5O/c1-12-10-18(2)6-7-20(12)15(21)11-19(3)14-5-4-13(8-16)9-17-14/h4-5,9,12H,6-7,10-11H2,1-3H3 |
| InChIKey | ZQPACFUWKBCOJT-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 63.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[[2-(2,4-dimethylpiperazin-1-yl)-2-oxoethyl]-methylamino]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[2-(2,4-dimethylpiperazin-1-yl)-2-oxoethyl]-methylamino]pyridine-3-carbonitrile?
The IUPAC name of 6-[[2-(2,4-dimethylpiperazin-1-yl)-2-oxoethyl]-methylamino]pyridine-3-carbonitrile (CID 71877355) is 6-[[2-(2,4-dimethylpiperazin-1-yl)-2-oxoethyl]-methylamino]pyridine-3-carbonitrile.
What is the SMILES notation for 6-[[2-(2,4-dimethylpiperazin-1-yl)-2-oxoethyl]-methylamino]pyridine-3-carbonitrile?
The canonical SMILES for 6-[[2-(2,4-dimethylpiperazin-1-yl)-2-oxoethyl]-methylamino]pyridine-3-carbonitrile is CC1CN(C)CCN1C(=O)CN(C)c1ccc(C#N)cn1.
What is the InChIKey of 6-[[2-(2,4-dimethylpiperazin-1-yl)-2-oxoethyl]-methylamino]pyridine-3-carbonitrile?
The InChIKey is ZQPACFUWKBCOJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N5O/c1-12-10-18(2)6-7-20(12)15(21)11-19(3)14-5-4-13(8-16)9-17-14/h4-5,9,12H,6-7,10-11H2,1-3H3.
What are the key properties of 6-[[2-(2,4-dimethylpiperazin-1-yl)-2-oxoethyl]-methylamino]pyridine-3-carbonitrile?
6-[[2-(2,4-dimethylpiperazin-1-yl)-2-oxoethyl]-methylamino]pyridine-3-carbonitrile has a molecular weight of 287.37 g/mol, XLogP of 0.55, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[2-(2,4-dimethylpiperazin-1-yl)-2-oxoethyl]-methylamino]pyridine-3-carbonitrile is sourced from PubChem (CID 71877355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).