About 1-ethyl-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]benzimidazol-2-one
1-ethyl-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]benzimidazol-2-one (PubChem CID 71877642) has the molecular formula C14H16N4O2
and a molecular weight of 272.31 g/mol. Its IUPAC name is 1-ethyl-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]benzimidazol-2-one.
Molecular Properties
| Compound Name | 1-ethyl-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]benzimidazol-2-one |
| PubChem CID | 71877642 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1-ethyl-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]benzimidazol-2-one |
| SMILES | CCc1nc(Cn2c(=O)n(CC)c3ccccc32)no1 |
| InChI | InChI=1S/C14H16N4O2/c1-3-13-15-12(16-20-13)9-18-11-8-6-5-7-10(11)17(4-2)14(18)19/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | WVOAPYCAIQAZPI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 65.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-ethyl-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]benzimidazol-2-one?
The IUPAC name of 1-ethyl-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]benzimidazol-2-one (CID 71877642) is 1-ethyl-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]benzimidazol-2-one.
What is the SMILES notation for 1-ethyl-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]benzimidazol-2-one?
The canonical SMILES for 1-ethyl-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]benzimidazol-2-one is CCc1nc(Cn2c(=O)n(CC)c3ccccc32)no1.
What is the InChIKey of 1-ethyl-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]benzimidazol-2-one?
The InChIKey is WVOAPYCAIQAZPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O2/c1-3-13-15-12(16-20-13)9-18-11-8-6-5-7-10(11)17(4-2)14(18)19/h5-8H,3-4,9H2,1-2H3.
What are the key properties of 1-ethyl-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]benzimidazol-2-one?
1-ethyl-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]benzimidazol-2-one has a molecular weight of 272.31 g/mol, XLogP of 1.82, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]benzimidazol-2-one is sourced from PubChem (CID 71877642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).