About methyl 5-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]furan-2-carboxylate
methyl 5-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]furan-2-carboxylate (PubChem CID 71878141) has the molecular formula C12H14N2O5S2
and a molecular weight of 330.39 g/mol. Its IUPAC name is methyl 5-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]furan-2-carboxylate |
| PubChem CID | 71878141 |
| Molecular Formula | C12H14N2O5S2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | methyl 5-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCCc2nc(C)cs2)o1 |
| InChI | InChI=1S/C12H14N2O5S2/c1-8-7-20-10(14-8)5-6-13-21(16,17)11-4-3-9(19-11)12(15)18-2/h3-4,7,13H,5-6H2,1-2H3 |
| InChIKey | FZZINYQMQKLNHK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 5-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]furan-2-carboxylate?
The IUPAC name of methyl 5-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]furan-2-carboxylate (CID 71878141) is methyl 5-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]furan-2-carboxylate.
What is the SMILES notation for methyl 5-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]furan-2-carboxylate?
The canonical SMILES for methyl 5-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]furan-2-carboxylate is COC(=O)c1ccc(S(=O)(=O)NCCc2nc(C)cs2)o1.
What is the InChIKey of methyl 5-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]furan-2-carboxylate?
The InChIKey is FZZINYQMQKLNHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O5S2/c1-8-7-20-10(14-8)5-6-13-21(16,17)11-4-3-9(19-11)12(15)18-2/h3-4,7,13H,5-6H2,1-2H3.
What are the key properties of methyl 5-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]furan-2-carboxylate?
methyl 5-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]furan-2-carboxylate has a molecular weight of 330.39 g/mol, XLogP of 1.35, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[2-(4-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]furan-2-carboxylate is sourced from PubChem (CID 71878141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).