C11H20F3IN4 — CID 71879086
2-methyl-1-prop-2-enyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 71879086) has the molecular formula C11H20F3IN4 and a molecular weight of 392.21 g/mol. Its IUPAC name is 2-methyl-1-prop-2-enyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-prop-2-enyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 71879086 |
| Molecular Formula | C11H20F3IN4 |
| Molecular Weight | 392.21 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 2-methyl-1-prop-2-enyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C=CCN/C(=N\C)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C11H19F3N4.HI/c1-3-5-16-10(15-2)17-9-4-6-18(7-9)8-11(12,13)14;/h3,9H,1,4-8H2,2H3,(H2,15,16,17);1H |
| InChIKey | CCSMKMBBHJKNEU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|