C13H22N+ — CID 7187916
(2S,6S)-1,1-dimethyl-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-ium (PubChem CID 7187916) has the molecular formula C13H22N+ and a molecular weight of 192.33 g/mol. Its IUPAC name is (2S,6S)-1,1-dimethyl-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-ium.
| Compound Name | (2S,6S)-1,1-dimethyl-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-ium |
|---|---|
| PubChem CID | 7187916 |
| Molecular Formula | C13H22N+ |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.17 |
| IUPAC Name | (2S,6S)-1,1-dimethyl-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-ium |
| SMILES | C=CC[C@H]1CC=C[C@H](CC=C)[N+]1(C)C |
| InChI | InChI=1S/C13H22N/c1-5-8-12-10-7-11-13(9-6-2)14(12,3)4/h5-7,10,12-13H,1-2,8-9,11H2,3-4H3/q+1/t12-,13-/m0/s1 |
| InChIKey | IAZILPDUJDGUJD-STQMWFEESA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|