About 3-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea
3-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea (PubChem CID 71879257) has the molecular formula C18H26ClN3O
and a molecular weight of 335.88 g/mol. Its IUPAC name is 3-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea.
Molecular Properties
| Compound Name | 3-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea |
| PubChem CID | 71879257 |
| Molecular Formula | C18H26ClN3O |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 3-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea |
| SMILES | CN1CCC(CN(C)C(=O)NC2CCc3c(Cl)cccc32)CC1 |
| InChI | InChI=1S/C18H26ClN3O/c1-21-10-8-13(9-11-21)12-22(2)18(23)20-17-7-6-14-15(17)4-3-5-16(14)19/h3-5,13,17H,6-12H2,1-2H3,(H,20,23) |
| InChIKey | FCNUWQIKLWHUHD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea?
The IUPAC name of 3-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea (CID 71879257) is 3-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea.
What is the SMILES notation for 3-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea?
The canonical SMILES for 3-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea is CN1CCC(CN(C)C(=O)NC2CCc3c(Cl)cccc32)CC1.
What is the InChIKey of 3-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea?
The InChIKey is FCNUWQIKLWHUHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26ClN3O/c1-21-10-8-13(9-11-21)12-22(2)18(23)20-17-7-6-14-15(17)4-3-5-16(14)19/h3-5,13,17H,6-12H2,1-2H3,(H,20,23).
What are the key properties of 3-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea?
3-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea has a molecular weight of 335.88 g/mol, XLogP of 3.31, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea is sourced from PubChem (CID 71879257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).