C20H25N3O3 — CID 71879421
ethyl 3-(cyclohex-3-en-1-ylmethylcarbamoyl)-2-phenyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 71879421) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is ethyl 3-(cyclohex-3-en-1-ylmethylcarbamoyl)-2-phenyl-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | ethyl 3-(cyclohex-3-en-1-ylmethylcarbamoyl)-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 71879421 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | ethyl 3-(cyclohex-3-en-1-ylmethylcarbamoyl)-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccccc2)C(C(=O)NCC2CC=CCC2)C1 |
| InChI | InChI=1S/C20H25N3O3/c1-2-26-20(25)17-13-18(23(22-17)16-11-7-4-8-12-16)19(24)21-14-15-9-5-3-6-10-15/h3-5,7-8,11-12,15,18H,2,6,9-10,13-14H2,1H3,(H,21,24) |
| InChIKey | STIFBGOXVRLTBQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|