C13H16F3N3O2 — CID 71879712
1,1,1-trifluoro-4-(furan-2-ylmethylamino)-2-(1-methylimidazol-2-yl)butan-2-ol (PubChem CID 71879712) has the molecular formula C13H16F3N3O2 and a molecular weight of 303.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(furan-2-ylmethylamino)-2-(1-methylimidazol-2-yl)butan-2-ol.
| Compound Name | 1,1,1-trifluoro-4-(furan-2-ylmethylamino)-2-(1-methylimidazol-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 71879712 |
| Molecular Formula | C13H16F3N3O2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1,1,1-trifluoro-4-(furan-2-ylmethylamino)-2-(1-methylimidazol-2-yl)butan-2-ol |
| SMILES | Cn1ccnc1C(O)(CCNCc1ccco1)C(F)(F)F |
| InChI | InChI=1S/C13H16F3N3O2/c1-19-7-6-18-11(19)12(20,13(14,15)16)4-5-17-9-10-3-2-8-21-10/h2-3,6-8,17,20H,4-5,9H2,1H3 |
| InChIKey | TZCUGHDUFGKNST-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|