About N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-3-(trifluoromethyl)pyridin-2-amine
N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 71879799) has the molecular formula C15H16F3N3O
and a molecular weight of 311.31 g/mol. Its IUPAC name is N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-3-(trifluoromethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-3-(trifluoromethyl)pyridin-2-amine |
| PubChem CID | 71879799 |
| Molecular Formula | C15H16F3N3O |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | COc1nc(C)cc(C)c1CNc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C15H16F3N3O/c1-9-7-10(2)21-14(22-3)11(9)8-20-13-12(15(16,17)18)5-4-6-19-13/h4-7H,8H2,1-3H3,(H,19,20) |
| InChIKey | WXFNYEOYLVMTRC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-3-(trifluoromethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-3-(trifluoromethyl)pyridin-2-amine?
The IUPAC name of N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-3-(trifluoromethyl)pyridin-2-amine (CID 71879799) is N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-3-(trifluoromethyl)pyridin-2-amine.
What is the SMILES notation for N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-3-(trifluoromethyl)pyridin-2-amine?
The canonical SMILES for N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-3-(trifluoromethyl)pyridin-2-amine is COc1nc(C)cc(C)c1CNc1ncccc1C(F)(F)F.
What is the InChIKey of N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-3-(trifluoromethyl)pyridin-2-amine?
The InChIKey is WXFNYEOYLVMTRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F3N3O/c1-9-7-10(2)21-14(22-3)11(9)8-20-13-12(15(16,17)18)5-4-6-19-13/h4-7H,8H2,1-3H3,(H,19,20).
What are the key properties of N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-3-(trifluoromethyl)pyridin-2-amine?
N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-3-(trifluoromethyl)pyridin-2-amine has a molecular weight of 311.31 g/mol, XLogP of 3.73, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-3-(trifluoromethyl)pyridin-2-amine is sourced from PubChem (CID 71879799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).