C17H24N4O2 — CID 71879940
N-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1H-indazole-7-carboxamide (PubChem CID 71879940) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1H-indazole-7-carboxamide.
| Compound Name | N-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 71879940 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1H-indazole-7-carboxamide |
| SMILES | COCCN1CCC(CNC(=O)c2cccc3cn[nH]c23)CC1 |
| InChI | InChI=1S/C17H24N4O2/c1-23-10-9-21-7-5-13(6-8-21)11-18-17(22)15-4-2-3-14-12-19-20-16(14)15/h2-4,12-13H,5-11H2,1H3,(H,18,22)(H,19,20) |
| InChIKey | DBFKLNAEIVZMNG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |