C18H20N4O — CID 71882484
2-tert-butyl-5-[2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]-1,3-oxazole-4-carbonitrile (PubChem CID 71882484) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-tert-butyl-5-[2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-tert-butyl-5-[2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 71882484 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-tert-butyl-5-[2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]-1,3-oxazole-4-carbonitrile |
| SMILES | CC(C)(C)c1nc(C#N)c(NN=C2CCCc3ccccc32)o1 |
| InChI | InChI=1S/C18H20N4O/c1-18(2,3)17-20-15(11-19)16(23-17)22-21-14-10-6-8-12-7-4-5-9-13(12)14/h4-5,7,9,22H,6,8,10H2,1-3H3 |
| InChIKey | LEUDHCVDZIVHQH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|