About N-[(3-phenyl-1,2-oxazol-5-yl)methylsulfonyl]oxane-4-carboxamide
N-[(3-phenyl-1,2-oxazol-5-yl)methylsulfonyl]oxane-4-carboxamide (PubChem CID 71882511) has the molecular formula C16H18N2O5S
and a molecular weight of 350.40 g/mol. Its IUPAC name is N-[(3-phenyl-1,2-oxazol-5-yl)methylsulfonyl]oxane-4-carboxamide.
Molecular Properties
| Compound Name | N-[(3-phenyl-1,2-oxazol-5-yl)methylsulfonyl]oxane-4-carboxamide |
| PubChem CID | 71882511 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-[(3-phenyl-1,2-oxazol-5-yl)methylsulfonyl]oxane-4-carboxamide |
| SMILES | O=C(NS(=O)(=O)Cc1cc(-c2ccccc2)no1)C1CCOCC1 |
| InChI | InChI=1S/C16H18N2O5S/c19-16(13-6-8-22-9-7-13)18-24(20,21)11-14-10-15(17-23-14)12-4-2-1-3-5-12/h1-5,10,13H,6-9,11H2,(H,18,19) |
| InChIKey | AOJLFVXIIVBIAM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(3-phenyl-1,2-oxazol-5-yl)methylsulfonyl]oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-phenyl-1,2-oxazol-5-yl)methylsulfonyl]oxane-4-carboxamide?
The IUPAC name of N-[(3-phenyl-1,2-oxazol-5-yl)methylsulfonyl]oxane-4-carboxamide (CID 71882511) is N-[(3-phenyl-1,2-oxazol-5-yl)methylsulfonyl]oxane-4-carboxamide.
What is the SMILES notation for N-[(3-phenyl-1,2-oxazol-5-yl)methylsulfonyl]oxane-4-carboxamide?
The canonical SMILES for N-[(3-phenyl-1,2-oxazol-5-yl)methylsulfonyl]oxane-4-carboxamide is O=C(NS(=O)(=O)Cc1cc(-c2ccccc2)no1)C1CCOCC1.
What is the InChIKey of N-[(3-phenyl-1,2-oxazol-5-yl)methylsulfonyl]oxane-4-carboxamide?
The InChIKey is AOJLFVXIIVBIAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O5S/c19-16(13-6-8-22-9-7-13)18-24(20,21)11-14-10-15(17-23-14)12-4-2-1-3-5-12/h1-5,10,13H,6-9,11H2,(H,18,19).
What are the key properties of N-[(3-phenyl-1,2-oxazol-5-yl)methylsulfonyl]oxane-4-carboxamide?
N-[(3-phenyl-1,2-oxazol-5-yl)methylsulfonyl]oxane-4-carboxamide has a molecular weight of 350.40 g/mol, XLogP of 1.71, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-phenyl-1,2-oxazol-5-yl)methylsulfonyl]oxane-4-carboxamide is sourced from PubChem (CID 71882511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).