About 4-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-ethylthieno[2,3-d]pyrimidine
4-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-ethylthieno[2,3-d]pyrimidine (PubChem CID 71882683) has the molecular formula C19H21N3OS
and a molecular weight of 339.46 g/mol. Its IUPAC name is 4-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-ethylthieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-ethylthieno[2,3-d]pyrimidine |
| PubChem CID | 71882683 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 4-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-ethylthieno[2,3-d]pyrimidine |
| SMILES | CCOc1ccc2c(c1)CN(c1ncnc3sc(CC)cc13)CC2 |
| InChI | InChI=1S/C19H21N3OS/c1-3-16-10-17-18(20-12-21-19(17)24-16)22-8-7-13-5-6-15(23-4-2)9-14(13)11-22/h5-6,9-10,12H,3-4,7-8,11H2,1-2H3 |
| InChIKey | RIKUMSUMTCHGOU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-ethylthieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-ethylthieno[2,3-d]pyrimidine?
The IUPAC name of 4-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-ethylthieno[2,3-d]pyrimidine (CID 71882683) is 4-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-ethylthieno[2,3-d]pyrimidine.
What is the SMILES notation for 4-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-ethylthieno[2,3-d]pyrimidine?
The canonical SMILES for 4-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-ethylthieno[2,3-d]pyrimidine is CCOc1ccc2c(c1)CN(c1ncnc3sc(CC)cc13)CC2.
What is the InChIKey of 4-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-ethylthieno[2,3-d]pyrimidine?
The InChIKey is RIKUMSUMTCHGOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3OS/c1-3-16-10-17-18(20-12-21-19(17)24-16)22-8-7-13-5-6-15(23-4-2)9-14(13)11-22/h5-6,9-10,12H,3-4,7-8,11H2,1-2H3.
What are the key properties of 4-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-ethylthieno[2,3-d]pyrimidine?
4-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-ethylthieno[2,3-d]pyrimidine has a molecular weight of 339.46 g/mol, XLogP of 4.22, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-ethylthieno[2,3-d]pyrimidine is sourced from PubChem (CID 71882683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).