About N'-[(3-methyl-1,2-oxazol-5-yl)methoxy]-4-(morpholin-4-ylmethyl)benzenecarboximidamide
N'-[(3-methyl-1,2-oxazol-5-yl)methoxy]-4-(morpholin-4-ylmethyl)benzenecarboximidamide (PubChem CID 71882995) has the molecular formula C17H22N4O3
and a molecular weight of 330.39 g/mol. Its IUPAC name is N'-[(3-methyl-1,2-oxazol-5-yl)methoxy]-4-(morpholin-4-ylmethyl)benzenecarboximidamide.
Molecular Properties
| Compound Name | N'-[(3-methyl-1,2-oxazol-5-yl)methoxy]-4-(morpholin-4-ylmethyl)benzenecarboximidamide |
| PubChem CID | 71882995 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N'-[(3-methyl-1,2-oxazol-5-yl)methoxy]-4-(morpholin-4-ylmethyl)benzenecarboximidamide |
| SMILES | Cc1cc(CO/N=C(/N)c2ccc(CN3CCOCC3)cc2)on1 |
| InChI | InChI=1S/C17H22N4O3/c1-13-10-16(24-19-13)12-23-20-17(18)15-4-2-14(3-5-15)11-21-6-8-22-9-7-21/h2-5,10H,6-9,11-12H2,1H3,(H2,18,20) |
| InChIKey | WFMDUPNNKIGYLE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(3-methyl-1,2-oxazol-5-yl)methoxy]-4-(morpholin-4-ylmethyl)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3-methyl-1,2-oxazol-5-yl)methoxy]-4-(morpholin-4-ylmethyl)benzenecarboximidamide?
The IUPAC name of N'-[(3-methyl-1,2-oxazol-5-yl)methoxy]-4-(morpholin-4-ylmethyl)benzenecarboximidamide (CID 71882995) is N'-[(3-methyl-1,2-oxazol-5-yl)methoxy]-4-(morpholin-4-ylmethyl)benzenecarboximidamide.
What is the SMILES notation for N'-[(3-methyl-1,2-oxazol-5-yl)methoxy]-4-(morpholin-4-ylmethyl)benzenecarboximidamide?
The canonical SMILES for N'-[(3-methyl-1,2-oxazol-5-yl)methoxy]-4-(morpholin-4-ylmethyl)benzenecarboximidamide is Cc1cc(CO/N=C(/N)c2ccc(CN3CCOCC3)cc2)on1.
What is the InChIKey of N'-[(3-methyl-1,2-oxazol-5-yl)methoxy]-4-(morpholin-4-ylmethyl)benzenecarboximidamide?
The InChIKey is WFMDUPNNKIGYLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O3/c1-13-10-16(24-19-13)12-23-20-17(18)15-4-2-14(3-5-15)11-21-6-8-22-9-7-21/h2-5,10H,6-9,11-12H2,1H3,(H2,18,20).
What are the key properties of N'-[(3-methyl-1,2-oxazol-5-yl)methoxy]-4-(morpholin-4-ylmethyl)benzenecarboximidamide?
N'-[(3-methyl-1,2-oxazol-5-yl)methoxy]-4-(morpholin-4-ylmethyl)benzenecarboximidamide has a molecular weight of 330.39 g/mol, XLogP of 1.65, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3-methyl-1,2-oxazol-5-yl)methoxy]-4-(morpholin-4-ylmethyl)benzenecarboximidamide is sourced from PubChem (CID 71882995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).