About 1-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(1-methylpyrazol-4-yl)methyl]urea
1-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(1-methylpyrazol-4-yl)methyl]urea (PubChem CID 71883199) has the molecular formula C18H17Cl2N5O2
and a molecular weight of 406.27 g/mol. Its IUPAC name is 1-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(1-methylpyrazol-4-yl)methyl]urea.
Molecular Properties
| Compound Name | 1-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(1-methylpyrazol-4-yl)methyl]urea |
| PubChem CID | 71883199 |
| Molecular Formula | C18H17Cl2N5O2 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 1-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(1-methylpyrazol-4-yl)methyl]urea |
| SMILES | Cn1cc(CNC(=O)Nc2ccc(=O)n(Cc3ccc(Cl)c(Cl)c3)c2)cn1 |
| InChI | InChI=1S/C18H17Cl2N5O2/c1-24-9-13(8-22-24)7-21-18(27)23-14-3-5-17(26)25(11-14)10-12-2-4-15(19)16(20)6-12/h2-6,8-9,11H,7,10H2,1H3,(H2,21,23,27) |
| InChIKey | LFEFMDAQRXVPDI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(1-methylpyrazol-4-yl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(1-methylpyrazol-4-yl)methyl]urea?
The IUPAC name of 1-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(1-methylpyrazol-4-yl)methyl]urea (CID 71883199) is 1-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(1-methylpyrazol-4-yl)methyl]urea.
What is the SMILES notation for 1-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(1-methylpyrazol-4-yl)methyl]urea?
The canonical SMILES for 1-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(1-methylpyrazol-4-yl)methyl]urea is Cn1cc(CNC(=O)Nc2ccc(=O)n(Cc3ccc(Cl)c(Cl)c3)c2)cn1.
What is the InChIKey of 1-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(1-methylpyrazol-4-yl)methyl]urea?
The InChIKey is LFEFMDAQRXVPDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2N5O2/c1-24-9-13(8-22-24)7-21-18(27)23-14-3-5-17(26)25(11-14)10-12-2-4-15(19)16(20)6-12/h2-6,8-9,11H,7,10H2,1H3,(H2,21,23,27).
What are the key properties of 1-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(1-methylpyrazol-4-yl)methyl]urea?
1-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(1-methylpyrazol-4-yl)methyl]urea has a molecular weight of 406.27 g/mol, XLogP of 3.26, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(1-methylpyrazol-4-yl)methyl]urea is sourced from PubChem (CID 71883199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).