About 3-oxopentan-2-yl 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate
3-oxopentan-2-yl 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate (PubChem CID 71883303) has the molecular formula C13H16N2O3S2
and a molecular weight of 312.42 g/mol. Its IUPAC name is 3-oxopentan-2-yl 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate.
Molecular Properties
| Compound Name | 3-oxopentan-2-yl 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate |
| PubChem CID | 71883303 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 3-oxopentan-2-yl 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate |
| SMILES | CCC(=O)C(C)OC(=O)c1cc2sc(N(C)C)nc2s1 |
| InChI | InChI=1S/C13H16N2O3S2/c1-5-8(16)7(2)18-12(17)10-6-9-11(19-10)14-13(20-9)15(3)4/h6-7H,5H2,1-4H3 |
| InChIKey | IGXIPXLMXNKCNB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-oxopentan-2-yl 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxopentan-2-yl 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate?
The IUPAC name of 3-oxopentan-2-yl 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate (CID 71883303) is 3-oxopentan-2-yl 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate.
What is the SMILES notation for 3-oxopentan-2-yl 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate?
The canonical SMILES for 3-oxopentan-2-yl 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate is CCC(=O)C(C)OC(=O)c1cc2sc(N(C)C)nc2s1.
What is the InChIKey of 3-oxopentan-2-yl 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate?
The InChIKey is IGXIPXLMXNKCNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O3S2/c1-5-8(16)7(2)18-12(17)10-6-9-11(19-10)14-13(20-9)15(3)4/h6-7H,5H2,1-4H3.
What are the key properties of 3-oxopentan-2-yl 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate?
3-oxopentan-2-yl 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate has a molecular weight of 312.42 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxopentan-2-yl 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate is sourced from PubChem (CID 71883303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).