C15H23F3N4O2S — CID 71883471
N-(1,3-thiazol-2-yl)-2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]propanamide (PubChem CID 71883471) has the molecular formula C15H23F3N4O2S and a molecular weight of 380.44 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]propanamide.
| Compound Name | N-(1,3-thiazol-2-yl)-2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 71883471 |
| Molecular Formula | C15H23F3N4O2S |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)Nc1nccs1)N1CCN(CCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H23F3N4O2S/c1-12(13(23)20-14-19-3-10-25-14)22-7-5-21(6-8-22)4-2-9-24-11-15(16,17)18/h3,10,12H,2,4-9,11H2,1H3,(H,19,20,23) |
| InChIKey | JIPBUJGVYXMDLA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|