About 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-5-phenyl-1,3-oxazole
2-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-5-phenyl-1,3-oxazole (PubChem CID 71883490) has the molecular formula C16H10N4O3S
and a molecular weight of 338.35 g/mol. Its IUPAC name is 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-5-phenyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-5-phenyl-1,3-oxazole |
| PubChem CID | 71883490 |
| Molecular Formula | C16H10N4O3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-5-phenyl-1,3-oxazole |
| SMILES | O=[N+]([O-])c1c(Sc2ncc(-c3ccccc3)o2)nc2ccccn12 |
| InChI | InChI=1S/C16H10N4O3S/c21-20(22)15-14(18-13-8-4-5-9-19(13)15)24-16-17-10-12(23-16)11-6-2-1-3-7-11/h1-10H |
| InChIKey | BTFTVFILRONUCV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-5-phenyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-5-phenyl-1,3-oxazole?
The IUPAC name of 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-5-phenyl-1,3-oxazole (CID 71883490) is 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-5-phenyl-1,3-oxazole.
What is the SMILES notation for 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-5-phenyl-1,3-oxazole?
The canonical SMILES for 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-5-phenyl-1,3-oxazole is O=[N+]([O-])c1c(Sc2ncc(-c3ccccc3)o2)nc2ccccn12.
What is the InChIKey of 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-5-phenyl-1,3-oxazole?
The InChIKey is BTFTVFILRONUCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N4O3S/c21-20(22)15-14(18-13-8-4-5-9-19(13)15)24-16-17-10-12(23-16)11-6-2-1-3-7-11/h1-10H.
What are the key properties of 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-5-phenyl-1,3-oxazole?
2-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-5-phenyl-1,3-oxazole has a molecular weight of 338.35 g/mol, XLogP of 4.05, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)sulfanyl-5-phenyl-1,3-oxazole is sourced from PubChem (CID 71883490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).