About N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]pyridine-3-sulfonamide
N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]pyridine-3-sulfonamide (PubChem CID 71884039) has the molecular formula C18H20N2O4S
and a molecular weight of 360.44 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]pyridine-3-sulfonamide |
| PubChem CID | 71884039 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NC1(c2ccc3c(c2)OCCO3)CCCC1)c1cccnc1 |
| InChI | InChI=1S/C18H20N2O4S/c21-25(22,15-4-3-9-19-13-15)20-18(7-1-2-8-18)14-5-6-16-17(12-14)24-11-10-23-16/h3-6,9,12-13,20H,1-2,7-8,10-11H2 |
| InChIKey | IVJJAEPXGUXMPC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]pyridine-3-sulfonamide?
The IUPAC name of N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]pyridine-3-sulfonamide (CID 71884039) is N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]pyridine-3-sulfonamide.
What is the SMILES notation for N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]pyridine-3-sulfonamide?
The canonical SMILES for N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]pyridine-3-sulfonamide is O=S(=O)(NC1(c2ccc3c(c2)OCCO3)CCCC1)c1cccnc1.
What is the InChIKey of N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]pyridine-3-sulfonamide?
The InChIKey is IVJJAEPXGUXMPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O4S/c21-25(22,15-4-3-9-19-13-15)20-18(7-1-2-8-18)14-5-6-16-17(12-14)24-11-10-23-16/h3-6,9,12-13,20H,1-2,7-8,10-11H2.
What are the key properties of N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]pyridine-3-sulfonamide?
N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]pyridine-3-sulfonamide has a molecular weight of 360.44 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]pyridine-3-sulfonamide is sourced from PubChem (CID 71884039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).