About [1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl 3-(hydroxymethyl)benzoate
[1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl 3-(hydroxymethyl)benzoate (PubChem CID 71884376) has the molecular formula C21H19FN2O3
and a molecular weight of 366.39 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl 3-(hydroxymethyl)benzoate.
Molecular Properties
| Compound Name | [1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl 3-(hydroxymethyl)benzoate |
| PubChem CID | 71884376 |
| Molecular Formula | C21H19FN2O3 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | [1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl 3-(hydroxymethyl)benzoate |
| SMILES | O=C(OCc1nn(-c2ccc(F)cc2)c2c1CCC2)c1cccc(CO)c1 |
| InChI | InChI=1S/C21H19FN2O3/c22-16-7-9-17(10-8-16)24-20-6-2-5-18(20)19(23-24)13-27-21(26)15-4-1-3-14(11-15)12-25/h1,3-4,7-11,25H,2,5-6,12-13H2 |
| InChIKey | ITIYBPPNMXCWEB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl 3-(hydroxymethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl 3-(hydroxymethyl)benzoate?
The IUPAC name of [1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl 3-(hydroxymethyl)benzoate (CID 71884376) is [1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl 3-(hydroxymethyl)benzoate.
What is the SMILES notation for [1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl 3-(hydroxymethyl)benzoate?
The canonical SMILES for [1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl 3-(hydroxymethyl)benzoate is O=C(OCc1nn(-c2ccc(F)cc2)c2c1CCC2)c1cccc(CO)c1.
What is the InChIKey of [1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl 3-(hydroxymethyl)benzoate?
The InChIKey is ITIYBPPNMXCWEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19FN2O3/c22-16-7-9-17(10-8-16)24-20-6-2-5-18(20)19(23-24)13-27-21(26)15-4-1-3-14(11-15)12-25/h1,3-4,7-11,25H,2,5-6,12-13H2.
What are the key properties of [1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl 3-(hydroxymethyl)benzoate?
[1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl 3-(hydroxymethyl)benzoate has a molecular weight of 366.39 g/mol, XLogP of 3.35, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl]methyl 3-(hydroxymethyl)benzoate is sourced from PubChem (CID 71884376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).