C21H21N3O2 — CID 71884844
2-(1,2-benzoxazol-3-yl)-N-[1-(2-methylpropyl)indol-5-yl]acetamide (PubChem CID 71884844) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-N-[1-(2-methylpropyl)indol-5-yl]acetamide.
| Compound Name | 2-(1,2-benzoxazol-3-yl)-N-[1-(2-methylpropyl)indol-5-yl]acetamide |
|---|---|
| PubChem CID | 71884844 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-N-[1-(2-methylpropyl)indol-5-yl]acetamide |
| SMILES | CC(C)Cn1ccc2cc(NC(=O)Cc3noc4ccccc34)ccc21 |
| InChI | InChI=1S/C21H21N3O2/c1-14(2)13-24-10-9-15-11-16(7-8-19(15)24)22-21(25)12-18-17-5-3-4-6-20(17)26-23-18/h3-11,14H,12-13H2,1-2H3,(H,22,25) |
| InChIKey | WHCKZNJVEWBSGP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |