C13H9F2N3O2S2 — CID 71885541
6-[1-(2,6-difluorophenyl)ethylsulfanyl]-5-nitroimidazo[2,1-b][1,3]thiazole (PubChem CID 71885541) has the molecular formula C13H9F2N3O2S2 and a molecular weight of 341.36 g/mol. Its IUPAC name is 6-[1-(2,6-difluorophenyl)ethylsulfanyl]-5-nitroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[1-(2,6-difluorophenyl)ethylsulfanyl]-5-nitroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 71885541 |
| Molecular Formula | C13H9F2N3O2S2 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 6-[1-(2,6-difluorophenyl)ethylsulfanyl]-5-nitroimidazo[2,1-b][1,3]thiazole |
| SMILES | CC(Sc1nc2sccn2c1[N+](=O)[O-])c1c(F)cccc1F |
| InChI | InChI=1S/C13H9F2N3O2S2/c1-7(10-8(14)3-2-4-9(10)15)22-11-12(18(19)20)17-5-6-21-13(17)16-11/h2-7H,1H3 |
| InChIKey | SWLOENOCWSNLFD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|