C15H27N3OS — CID 71885574
N-(1-methylpiperidin-4-yl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-4-carbothioamide (PubChem CID 71885574) has the molecular formula C15H27N3OS and a molecular weight of 297.47 g/mol. Its IUPAC name is N-(1-methylpiperidin-4-yl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-4-carbothioamide.
| Compound Name | N-(1-methylpiperidin-4-yl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-4-carbothioamide |
|---|---|
| PubChem CID | 71885574 |
| Molecular Formula | C15H27N3OS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | N-(1-methylpiperidin-4-yl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-4-carbothioamide |
| SMILES | CN1CCC(NC(=S)N2CCOC3CCCCC32)CC1 |
| InChI | InChI=1S/C15H27N3OS/c1-17-8-6-12(7-9-17)16-15(20)18-10-11-19-14-5-3-2-4-13(14)18/h12-14H,2-11H2,1H3,(H,16,20) |
| InChIKey | HIKKYDUIKONYIQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|