About N-cycloheptyl-5-(2,5-dimethylpyrrol-1-yl)-N,1-dimethylpyrazole-4-carboxamide
N-cycloheptyl-5-(2,5-dimethylpyrrol-1-yl)-N,1-dimethylpyrazole-4-carboxamide (PubChem CID 71886271) has the molecular formula C19H28N4O
and a molecular weight of 328.46 g/mol. Its IUPAC name is N-cycloheptyl-5-(2,5-dimethylpyrrol-1-yl)-N,1-dimethylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-cycloheptyl-5-(2,5-dimethylpyrrol-1-yl)-N,1-dimethylpyrazole-4-carboxamide |
| PubChem CID | 71886271 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | N-cycloheptyl-5-(2,5-dimethylpyrrol-1-yl)-N,1-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1ccc(C)n1-c1c(C(=O)N(C)C2CCCCCC2)cnn1C |
| InChI | InChI=1S/C19H28N4O/c1-14-11-12-15(2)23(14)18-17(13-20-22(18)4)19(24)21(3)16-9-7-5-6-8-10-16/h11-13,16H,5-10H2,1-4H3 |
| InChIKey | REELBFYRTBFCRF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cycloheptyl-5-(2,5-dimethylpyrrol-1-yl)-N,1-dimethylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-5-(2,5-dimethylpyrrol-1-yl)-N,1-dimethylpyrazole-4-carboxamide?
The IUPAC name of N-cycloheptyl-5-(2,5-dimethylpyrrol-1-yl)-N,1-dimethylpyrazole-4-carboxamide (CID 71886271) is N-cycloheptyl-5-(2,5-dimethylpyrrol-1-yl)-N,1-dimethylpyrazole-4-carboxamide.
What is the SMILES notation for N-cycloheptyl-5-(2,5-dimethylpyrrol-1-yl)-N,1-dimethylpyrazole-4-carboxamide?
The canonical SMILES for N-cycloheptyl-5-(2,5-dimethylpyrrol-1-yl)-N,1-dimethylpyrazole-4-carboxamide is Cc1ccc(C)n1-c1c(C(=O)N(C)C2CCCCCC2)cnn1C.
What is the InChIKey of N-cycloheptyl-5-(2,5-dimethylpyrrol-1-yl)-N,1-dimethylpyrazole-4-carboxamide?
The InChIKey is REELBFYRTBFCRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4O/c1-14-11-12-15(2)23(14)18-17(13-20-22(18)4)19(24)21(3)16-9-7-5-6-8-10-16/h11-13,16H,5-10H2,1-4H3.
What are the key properties of N-cycloheptyl-5-(2,5-dimethylpyrrol-1-yl)-N,1-dimethylpyrazole-4-carboxamide?
N-cycloheptyl-5-(2,5-dimethylpyrrol-1-yl)-N,1-dimethylpyrazole-4-carboxamide has a molecular weight of 328.46 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-5-(2,5-dimethylpyrrol-1-yl)-N,1-dimethylpyrazole-4-carboxamide is sourced from PubChem (CID 71886271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).