About (1-cyanoindolizin-2-yl)methyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate
(1-cyanoindolizin-2-yl)methyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 71887726) has the molecular formula C18H12ClN3O3S
and a molecular weight of 385.83 g/mol. Its IUPAC name is (1-cyanoindolizin-2-yl)methyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | (1-cyanoindolizin-2-yl)methyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| PubChem CID | 71887726 |
| Molecular Formula | C18H12ClN3O3S |
| Molecular Weight | 385.83 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | (1-cyanoindolizin-2-yl)methyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | N#Cc1c(COC(=O)C2CC(c3ccc(Cl)s3)=NO2)cn2ccccc12 |
| InChI | InChI=1S/C18H12ClN3O3S/c19-17-5-4-16(26-17)13-7-15(25-21-13)18(23)24-10-11-9-22-6-2-1-3-14(22)12(11)8-20/h1-6,9,15H,7,10H2 |
| InChIKey | OVNPWLBNPMBKEI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 76.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.83 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (1-cyanoindolizin-2-yl)methyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyanoindolizin-2-yl)methyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
The IUPAC name of (1-cyanoindolizin-2-yl)methyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate (CID 71887726) is (1-cyanoindolizin-2-yl)methyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
What is the SMILES notation for (1-cyanoindolizin-2-yl)methyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
The canonical SMILES for (1-cyanoindolizin-2-yl)methyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate is N#Cc1c(COC(=O)C2CC(c3ccc(Cl)s3)=NO2)cn2ccccc12.
What is the InChIKey of (1-cyanoindolizin-2-yl)methyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
The InChIKey is OVNPWLBNPMBKEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClN3O3S/c19-17-5-4-16(26-17)13-7-15(25-21-13)18(23)24-10-11-9-22-6-2-1-3-14(22)12(11)8-20/h1-6,9,15H,7,10H2.
What are the key properties of (1-cyanoindolizin-2-yl)methyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
(1-cyanoindolizin-2-yl)methyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate has a molecular weight of 385.83 g/mol, XLogP of 3.76, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyanoindolizin-2-yl)methyl 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 71887726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).