C19H23N3O3 — CID 71888766
N'-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N'-methyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)oxamide (PubChem CID 71888766) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N'-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N'-methyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)oxamide.
| Compound Name | N'-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N'-methyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)oxamide |
|---|---|
| PubChem CID | 71888766 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N'-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N'-methyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)oxamide |
| SMILES | Cc1noc(C)c1CN(C)C(=O)C(=O)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C19H23N3O3/c1-12-16(13(2)25-21-12)11-22(3)19(24)18(23)20-17-10-6-8-14-7-4-5-9-15(14)17/h6,8,10H,4-5,7,9,11H2,1-3H3,(H,20,23) |
| InChIKey | UIAQCBILUVVECO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|