About 2-cyano-N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]acetamide
2-cyano-N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]acetamide (PubChem CID 7188891) has the molecular formula C13H21N3O
and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-cyano-N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]acetamide.
Molecular Properties
| Compound Name | 2-cyano-N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]acetamide |
| PubChem CID | 7188891 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2-cyano-N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]acetamide |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C/C1=N/NC(=O)CC#N |
| InChI | InChI=1S/C13H21N3O/c1-9(2)11-5-4-10(3)8-12(11)15-16-13(17)6-7-14/h9-11H,4-6,8H2,1-3H3,(H,16,17)/b15-12-/t10-,11+/m1/s1 |
| InChIKey | AIFKMVJOMZBXPK-FXWNEQAGSA-N |
| XLogP | 2.46 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]acetamide?
The IUPAC name of 2-cyano-N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]acetamide (CID 7188891) is 2-cyano-N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]acetamide.
What is the SMILES notation for 2-cyano-N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]acetamide?
The canonical SMILES for 2-cyano-N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]acetamide is CC(C)[C@@H]1CC[C@@H](C)C/C1=N/NC(=O)CC#N.
What is the InChIKey of 2-cyano-N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]acetamide?
The InChIKey is AIFKMVJOMZBXPK-FXWNEQAGSA-N. The full InChI is InChI=1S/C13H21N3O/c1-9(2)11-5-4-10(3)8-12(11)15-16-13(17)6-7-14/h9-11H,4-6,8H2,1-3H3,(H,16,17)/b15-12-/t10-,11+/m1/s1.
What are the key properties of 2-cyano-N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]acetamide?
2-cyano-N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]acetamide has a molecular weight of 235.33 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[(Z)-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]amino]acetamide is sourced from PubChem (CID 7188891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).