C19H17Cl2N5O — CID 71889557
1-[3-(3,4-dichlorophenyl)phenyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)urea (PubChem CID 71889557) has the molecular formula C19H17Cl2N5O and a molecular weight of 402.29 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenyl)phenyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)urea.
| Compound Name | 1-[3-(3,4-dichlorophenyl)phenyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)urea |
|---|---|
| PubChem CID | 71889557 |
| Molecular Formula | C19H17Cl2N5O |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 1-[3-(3,4-dichlorophenyl)phenyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)urea |
| SMILES | O=C(NCc1nnc2n1CCC2)Nc1cccc(-c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H17Cl2N5O/c20-15-7-6-13(10-16(15)21)12-3-1-4-14(9-12)23-19(27)22-11-18-25-24-17-5-2-8-26(17)18/h1,3-4,6-7,9-10H,2,5,8,11H2,(H2,22,23,27) |
| InChIKey | GETVJHNEQWTMEV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |