About 1-(2,5-difluorophenyl)ethyl 1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxylate
1-(2,5-difluorophenyl)ethyl 1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 71889718) has the molecular formula C17H19F2NO3
and a molecular weight of 323.34 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)ethyl 1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | 1-(2,5-difluorophenyl)ethyl 1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxylate |
| PubChem CID | 71889718 |
| Molecular Formula | C17H19F2NO3 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-(2,5-difluorophenyl)ethyl 1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CC(OC(=O)C1CC(=O)N(CC2CC2)C1)c1cc(F)ccc1F |
| InChI | InChI=1S/C17H19F2NO3/c1-10(14-7-13(18)4-5-15(14)19)23-17(22)12-6-16(21)20(9-12)8-11-2-3-11/h4-5,7,10-12H,2-3,6,8-9H2,1H3 |
| InChIKey | VTXXMLJYMKYNGH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,5-difluorophenyl)ethyl 1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-difluorophenyl)ethyl 1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxylate?
The IUPAC name of 1-(2,5-difluorophenyl)ethyl 1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxylate (CID 71889718) is 1-(2,5-difluorophenyl)ethyl 1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxylate.
What is the SMILES notation for 1-(2,5-difluorophenyl)ethyl 1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxylate?
The canonical SMILES for 1-(2,5-difluorophenyl)ethyl 1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxylate is CC(OC(=O)C1CC(=O)N(CC2CC2)C1)c1cc(F)ccc1F.
What is the InChIKey of 1-(2,5-difluorophenyl)ethyl 1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxylate?
The InChIKey is VTXXMLJYMKYNGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F2NO3/c1-10(14-7-13(18)4-5-15(14)19)23-17(22)12-6-16(21)20(9-12)8-11-2-3-11/h4-5,7,10-12H,2-3,6,8-9H2,1H3.
What are the key properties of 1-(2,5-difluorophenyl)ethyl 1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxylate?
1-(2,5-difluorophenyl)ethyl 1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxylate has a molecular weight of 323.34 g/mol, XLogP of 2.83, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-difluorophenyl)ethyl 1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxylate is sourced from PubChem (CID 71889718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).