About [(Z)-[amino-(4-chlorophenyl)methylidene]amino] (2R)-3,4-dihydro-2H-chromene-2-carboxylate
[(Z)-[amino-(4-chlorophenyl)methylidene]amino] (2R)-3,4-dihydro-2H-chromene-2-carboxylate (PubChem CID 7189002) has the molecular formula C17H15ClN2O3
and a molecular weight of 330.77 g/mol. Its IUPAC name is [(Z)-[amino-(4-chlorophenyl)methylidene]amino] (2R)-3,4-dihydro-2H-chromene-2-carboxylate.
Molecular Properties
| Compound Name | [(Z)-[amino-(4-chlorophenyl)methylidene]amino] (2R)-3,4-dihydro-2H-chromene-2-carboxylate |
| PubChem CID | 7189002 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | [(Z)-[amino-(4-chlorophenyl)methylidene]amino] (2R)-3,4-dihydro-2H-chromene-2-carboxylate |
| SMILES | N/C(=N\OC(=O)[C@H]1CCc2ccccc2O1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClN2O3/c18-13-8-5-12(6-9-13)16(19)20-23-17(21)15-10-7-11-3-1-2-4-14(11)22-15/h1-6,8-9,15H,7,10H2,(H2,19,20)/t15-/m1/s1 |
| InChIKey | IRTJYOMLANVGSM-OAHLLOKOSA-N |
| XLogP | 2.90 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[amino-(4-chlorophenyl)methylidene]amino] (2R)-3,4-dihydro-2H-chromene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[amino-(4-chlorophenyl)methylidene]amino] (2R)-3,4-dihydro-2H-chromene-2-carboxylate?
The IUPAC name of [(Z)-[amino-(4-chlorophenyl)methylidene]amino] (2R)-3,4-dihydro-2H-chromene-2-carboxylate (CID 7189002) is [(Z)-[amino-(4-chlorophenyl)methylidene]amino] (2R)-3,4-dihydro-2H-chromene-2-carboxylate.
What is the SMILES notation for [(Z)-[amino-(4-chlorophenyl)methylidene]amino] (2R)-3,4-dihydro-2H-chromene-2-carboxylate?
The canonical SMILES for [(Z)-[amino-(4-chlorophenyl)methylidene]amino] (2R)-3,4-dihydro-2H-chromene-2-carboxylate is N/C(=N\OC(=O)[C@H]1CCc2ccccc2O1)c1ccc(Cl)cc1.
What is the InChIKey of [(Z)-[amino-(4-chlorophenyl)methylidene]amino] (2R)-3,4-dihydro-2H-chromene-2-carboxylate?
The InChIKey is IRTJYOMLANVGSM-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H15ClN2O3/c18-13-8-5-12(6-9-13)16(19)20-23-17(21)15-10-7-11-3-1-2-4-14(11)22-15/h1-6,8-9,15H,7,10H2,(H2,19,20)/t15-/m1/s1.
What are the key properties of [(Z)-[amino-(4-chlorophenyl)methylidene]amino] (2R)-3,4-dihydro-2H-chromene-2-carboxylate?
[(Z)-[amino-(4-chlorophenyl)methylidene]amino] (2R)-3,4-dihydro-2H-chromene-2-carboxylate has a molecular weight of 330.77 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[amino-(4-chlorophenyl)methylidene]amino] (2R)-3,4-dihydro-2H-chromene-2-carboxylate is sourced from PubChem (CID 7189002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).