About 3,3-dicyclopropyl-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide
3,3-dicyclopropyl-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide (PubChem CID 71890103) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 3,3-dicyclopropyl-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide.
Molecular Properties
| Compound Name | 3,3-dicyclopropyl-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide |
| PubChem CID | 71890103 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 3,3-dicyclopropyl-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(C=C(C1CC1)C1CC1)NCC1COCCO1 |
| InChI | InChI=1S/C14H21NO3/c16-14(15-8-12-9-17-5-6-18-12)7-13(10-1-2-10)11-3-4-11/h7,10-12H,1-6,8-9H2,(H,15,16) |
| InChIKey | WVWBCSBPSHLPCG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dicyclopropyl-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dicyclopropyl-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide?
The IUPAC name of 3,3-dicyclopropyl-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide (CID 71890103) is 3,3-dicyclopropyl-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide.
What is the SMILES notation for 3,3-dicyclopropyl-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide?
The canonical SMILES for 3,3-dicyclopropyl-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide is O=C(C=C(C1CC1)C1CC1)NCC1COCCO1.
What is the InChIKey of 3,3-dicyclopropyl-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide?
The InChIKey is WVWBCSBPSHLPCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3/c16-14(15-8-12-9-17-5-6-18-12)7-13(10-1-2-10)11-3-4-11/h7,10-12H,1-6,8-9H2,(H,15,16).
What are the key properties of 3,3-dicyclopropyl-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide?
3,3-dicyclopropyl-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide has a molecular weight of 251.33 g/mol, XLogP of 1.26, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dicyclopropyl-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide is sourced from PubChem (CID 71890103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).