C17H17F3N4O — CID 71890557
3,3-dicyclopropyl-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]prop-2-enamide (PubChem CID 71890557) has the molecular formula C17H17F3N4O and a molecular weight of 350.34 g/mol. Its IUPAC name is 3,3-dicyclopropyl-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]prop-2-enamide.
| Compound Name | 3,3-dicyclopropyl-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 71890557 |
| Molecular Formula | C17H17F3N4O |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 3,3-dicyclopropyl-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]prop-2-enamide |
| SMILES | O=C(C=C(C1CC1)C1CC1)NCc1nnc2ccc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C17H17F3N4O/c18-17(19,20)12-5-6-14-22-23-15(24(14)9-12)8-21-16(25)7-13(10-1-2-10)11-3-4-11/h5-7,9-11H,1-4,8H2,(H,21,25) |
| InChIKey | ZOKYKUPRSYCJGR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|