C16H14F3N3O3 — CID 71890702
6-cyclopropyl-2-[(2-methyl-3-nitrophenyl)methyl]-4-(trifluoromethyl)pyridazin-3-one (PubChem CID 71890702) has the molecular formula C16H14F3N3O3 and a molecular weight of 353.30 g/mol. Its IUPAC name is 6-cyclopropyl-2-[(2-methyl-3-nitrophenyl)methyl]-4-(trifluoromethyl)pyridazin-3-one.
| Compound Name | 6-cyclopropyl-2-[(2-methyl-3-nitrophenyl)methyl]-4-(trifluoromethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 71890702 |
| Molecular Formula | C16H14F3N3O3 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 6-cyclopropyl-2-[(2-methyl-3-nitrophenyl)methyl]-4-(trifluoromethyl)pyridazin-3-one |
| SMILES | Cc1c(Cn2nc(C3CC3)cc(C(F)(F)F)c2=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14F3N3O3/c1-9-11(3-2-4-14(9)22(24)25)8-21-15(23)12(16(17,18)19)7-13(20-21)10-5-6-10/h2-4,7,10H,5-6,8H2,1H3 |
| InChIKey | SEPUXBSYEPBTOV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|